C13H17BrIN3S — CID 105000414
2-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine (PubChem CID 105000414) has the molecular formula C13H17BrIN3S and a molecular weight of 454.18 g/mol. Its IUPAC name is 2-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine.
| Compound Name | 2-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 105000414 |
| Molecular Formula | C13H17BrIN3S |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 2-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
| SMILES | CCNC(Cc1c(Br)c(C)nn1C)c1csc(I)c1 |
| InChI | InChI=1S/C13H17BrIN3S/c1-4-16-10(9-5-12(15)19-7-9)6-11-13(14)8(2)17-18(11)3/h5,7,10,16H,4,6H2,1-3H3 |
| InChIKey | BPQVZUBLZRTMKO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|