About Se-(4-iodophenyl) N,N-diethylcarbamoselenoate
Se-(4-iodophenyl) N,N-diethylcarbamoselenoate (PubChem CID 10500075) has the molecular formula C11H14INOSe
and a molecular weight of 382.10 g/mol. Its IUPAC name is Se-(4-iodophenyl) N,N-diethylcarbamoselenoate.
Molecular Properties
| Compound Name | Se-(4-iodophenyl) N,N-diethylcarbamoselenoate |
| PubChem CID | 10500075 |
| Molecular Formula | C11H14INOSe |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 382.93 |
| IUPAC Name | Se-(4-iodophenyl) N,N-diethylcarbamoselenoate |
| SMILES | CCN(CC)C(=O)[Se]c1ccc(I)cc1 |
| InChI | InChI=1S/C11H14INOSe/c1-3-13(4-2)11(14)15-10-7-5-9(12)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | JFFMLYRIKOLZRY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze Se-(4-iodophenyl) N,N-diethylcarbamoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-(4-iodophenyl) N,N-diethylcarbamoselenoate?
The IUPAC name of Se-(4-iodophenyl) N,N-diethylcarbamoselenoate (CID 10500075) is Se-(4-iodophenyl) N,N-diethylcarbamoselenoate.
What is the SMILES notation for Se-(4-iodophenyl) N,N-diethylcarbamoselenoate?
The canonical SMILES for Se-(4-iodophenyl) N,N-diethylcarbamoselenoate is CCN(CC)C(=O)[Se]c1ccc(I)cc1.
What is the InChIKey of Se-(4-iodophenyl) N,N-diethylcarbamoselenoate?
The InChIKey is JFFMLYRIKOLZRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14INOSe/c1-3-13(4-2)11(14)15-10-7-5-9(12)6-8-10/h5-8H,3-4H2,1-2H3.
What are the key properties of Se-(4-iodophenyl) N,N-diethylcarbamoselenoate?
Se-(4-iodophenyl) N,N-diethylcarbamoselenoate has a molecular weight of 382.10 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Se-(4-iodophenyl) N,N-diethylcarbamoselenoate is sourced from PubChem (CID 10500075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).