C12H19NO — CID 105000824
1-(5-ethylfuran-2-yl)-N-propylprop-2-en-1-amine (PubChem CID 105000824) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(5-ethylfuran-2-yl)-N-propylprop-2-en-1-amine.
| Compound Name | 1-(5-ethylfuran-2-yl)-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105000824 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(5-ethylfuran-2-yl)-N-propylprop-2-en-1-amine |
| SMILES | C=CC(NCCC)c1ccc(CC)o1 |
| InChI | InChI=1S/C12H19NO/c1-4-9-13-11(6-3)12-8-7-10(5-2)14-12/h6-8,11,13H,3-5,9H2,1-2H3 |
| InChIKey | MPDYSLBBHSCZFJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|