About 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine
1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine (PubChem CID 105001034) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine |
| PubChem CID | 105001034 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine |
| SMILES | C=CC(N)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C10H19NO/c1-5-9(11)10-6(2)7(3)12-8(10)4/h5-10H,1,11H2,2-4H3 |
| InChIKey | GOLKIVIWEQRSGI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine?
The IUPAC name of 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine (CID 105001034) is 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine.
What is the SMILES notation for 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine?
The canonical SMILES for 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine is C=CC(N)C1C(C)OC(C)C1C.
What is the InChIKey of 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine?
The InChIKey is GOLKIVIWEQRSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-5-9(11)10-6(2)7(3)12-8(10)4/h5-10H,1,11H2,2-4H3.
What are the key properties of 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine?
1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine has a molecular weight of 169.27 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,5-trimethyloxolan-3-yl)prop-2-en-1-amine is sourced from PubChem (CID 105001034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).