About 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol
9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol (PubChem CID 10500128) has the molecular formula C25H34O3
and a molecular weight of 382.54 g/mol. Its IUPAC name is 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol.
Molecular Properties
| Compound Name | 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol |
| PubChem CID | 10500128 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)c1ccc(CO)cc1-2 |
| InChI | InChI=1S/C25H34O3/c1-6-7-8-9-12-24(2,3)18-14-21(27)23-19-13-17(16-26)10-11-20(19)25(4,5)28-22(23)15-18/h10-11,13-15,26-27H,6-9,12,16H2,1-5H3 |
| InChIKey | KAXNKZYLOMFBHO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol?
The IUPAC name of 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol (CID 10500128) is 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol.
What is the SMILES notation for 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol?
The canonical SMILES for 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol is CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)c1ccc(CO)cc1-2.
What is the InChIKey of 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol?
The InChIKey is KAXNKZYLOMFBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O3/c1-6-7-8-9-12-24(2,3)18-14-21(27)23-19-13-17(16-26)10-11-20(19)25(4,5)28-22(23)15-18/h10-11,13-15,26-27H,6-9,12,16H2,1-5H3.
What are the key properties of 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol?
9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol has a molecular weight of 382.54 g/mol, XLogP of 6.43, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-1-ol is sourced from PubChem (CID 10500128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).