C23H29NO4 — CID 10500185
N-benzyl-N-[(1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]prop-2-enyl]hydroxylamine (PubChem CID 10500185) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]prop-2-enyl]hydroxylamine.
| Compound Name | N-benzyl-N-[(1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]prop-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 10500185 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-benzyl-N-[(1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]prop-2-enyl]hydroxylamine |
| SMILES | C=C[C@@H]([C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-4-20(24(25)15-18-11-7-5-8-12-18)22-21(27-23(2,3)28-22)17-26-16-19-13-9-6-10-14-19/h4-14,20-22,25H,1,15-17H2,2-3H3/t20-,21-,22-/m0/s1 |
| InChIKey | YOZXUKLWYKILEX-FKBYEOEOSA-N |
| XLogP | 4.17 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|