C12H24N4 — CID 105002075
1-(2-ethyl-1,2,4-triazol-3-yl)octan-2-amine (PubChem CID 105002075) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)octan-2-amine.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)octan-2-amine |
|---|---|
| PubChem CID | 105002075 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)octan-2-amine |
| SMILES | CCCCCCC(N)Cc1ncnn1CC |
| InChI | InChI=1S/C12H24N4/c1-3-5-6-7-8-11(13)9-12-14-10-15-16(12)4-2/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | PGWNVBHGYUOTAN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|