C19H28O8 — CID 10500224
(2S)-2-[(1R,4S)-4-[2-(2,2-dimethylpropanoyloxy)-1,3-dimethoxy-1,3-dioxopropan-2-yl]cyclohex-2-en-1-yl]propanoic acid (PubChem CID 10500224) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is (2S)-2-[(1R,4S)-4-[2-(2,2-dimethylpropanoyloxy)-1,3-dimethoxy-1,3-dioxopropan-2-yl]cyclohex-2-en-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(1R,4S)-4-[2-(2,2-dimethylpropanoyloxy)-1,3-dimethoxy-1,3-dioxopropan-2-yl]cyclohex-2-en-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10500224 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-2-[(1R,4S)-4-[2-(2,2-dimethylpropanoyloxy)-1,3-dimethoxy-1,3-dioxopropan-2-yl]cyclohex-2-en-1-yl]propanoic acid |
| SMILES | COC(=O)C(OC(=O)C(C)(C)C)(C(=O)OC)[C@@H]1C=C[C@H]([C@H](C)C(=O)O)CC1 |
| InChI | InChI=1S/C19H28O8/c1-11(14(20)21)12-7-9-13(10-8-12)19(16(23)25-5,17(24)26-6)27-15(22)18(2,3)4/h7,9,11-13H,8,10H2,1-6H3,(H,20,21)/t11-,12-,13+/m0/s1 |
| InChIKey | PCVPXZBYQJLJEX-RWMBFGLXSA-N |
| XLogP | 1.96 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|