C10H13IN4S — CID 105002287
2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-iodothiophen-3-yl)ethanamine (PubChem CID 105002287) has the molecular formula C10H13IN4S and a molecular weight of 348.21 g/mol. Its IUPAC name is 2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-iodothiophen-3-yl)ethanamine.
| Compound Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-iodothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 105002287 |
| Molecular Formula | C10H13IN4S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-iodothiophen-3-yl)ethanamine |
| SMILES | CCn1ncnc1CC(N)c1csc(I)c1 |
| InChI | InChI=1S/C10H13IN4S/c1-2-15-10(13-6-14-15)4-8(12)7-3-9(11)16-5-7/h3,5-6,8H,2,4,12H2,1H3 |
| InChIKey | LALLVGHACHZGJY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|