C14H14INS — CID 105003735
2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(5-iodothiophen-3-yl)ethanamine (PubChem CID 105003735) has the molecular formula C14H14INS and a molecular weight of 355.24 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(5-iodothiophen-3-yl)ethanamine.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(5-iodothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 105003735 |
| Molecular Formula | C14H14INS |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(5-iodothiophen-3-yl)ethanamine |
| SMILES | NC(CC1Cc2ccccc21)c1csc(I)c1 |
| InChI | InChI=1S/C14H14INS/c15-14-7-11(8-17-14)13(16)6-10-5-9-3-1-2-4-12(9)10/h1-4,7-8,10,13H,5-6,16H2 |
| InChIKey | GXDBNKHTHPYJRK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|