C12H15ClFN — CID 105003778
1-(2-chloro-3-fluorophenyl)-N,3-dimethylbut-3-en-1-amine (PubChem CID 105003778) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-N,3-dimethylbut-3-en-1-amine.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-N,3-dimethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105003778 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-N,3-dimethylbut-3-en-1-amine |
| SMILES | C=C(C)CC(NC)c1cccc(F)c1Cl |
| InChI | InChI=1S/C12H15ClFN/c1-8(2)7-11(15-3)9-5-4-6-10(14)12(9)13/h4-6,11,15H,1,7H2,2-3H3 |
| InChIKey | FNPPMFRQHAPBBH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|