C23H34O3Si — CID 10500389
7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-9-(6-oxocyclohexen-1-yl)nona-2,8-diynal (PubChem CID 10500389) has the molecular formula C23H34O3Si and a molecular weight of 386.61 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-9-(6-oxocyclohexen-1-yl)nona-2,8-diynal.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-9-(6-oxocyclohexen-1-yl)nona-2,8-diynal |
|---|---|
| PubChem CID | 10500389 |
| Molecular Formula | C23H34O3Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-9-(6-oxocyclohexen-1-yl)nona-2,8-diynal |
| SMILES | CC(C)(C#CC=O)CCC(C#CC1=CCCCC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34O3Si/c1-22(2,3)27(6,7)26-20(15-17-23(4,5)16-10-18-24)14-13-19-11-8-9-12-21(19)25/h11,18,20H,8-9,12,15,17H2,1-7H3 |
| InChIKey | PFOAEINDYRKRHL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|