C16H21NO8S — CID 10500409
[(1R,2S,6S,9R,11R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate (PubChem CID 10500409) has the molecular formula C16H21NO8S and a molecular weight of 387.41 g/mol. Its IUPAC name is [(1R,2S,6S,9R,11R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate.
| Compound Name | [(1R,2S,6S,9R,11R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 10500409 |
| Molecular Formula | C16H21NO8S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | [(1R,2S,6S,9R,11R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@H]2[C@@H]3O[C@H](c4ccccc4)O[C@@H]3CO[C@@]2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C16H21NO8S/c1-15(2)24-13-12-11(22-14(23-12)10-6-4-3-5-7-10)8-20-16(13,25-15)9-21-26(17,18)19/h3-7,11-14H,8-9H2,1-2H3,(H2,17,18,19)/t11-,12-,13+,14-,16+/m1/s1 |
| InChIKey | SIACVZOVKIDUON-SSZWKKLZSA-N |
| XLogP | 0.57 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |