C16H25N — CID 105004182
1-(3,4-dimethylphenyl)-3-methyl-N-propylbut-3-en-1-amine (PubChem CID 105004182) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-methyl-N-propylbut-3-en-1-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-3-methyl-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105004182 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-methyl-N-propylbut-3-en-1-amine |
| SMILES | C=C(C)CC(NCCC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H25N/c1-6-9-17-16(10-12(2)3)15-8-7-13(4)14(5)11-15/h7-8,11,16-17H,2,6,9-10H2,1,3-5H3 |
| InChIKey | YRVQSPJYSQKBQK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|