C12H16FNO — CID 105004270
1-(3-fluoro-4-methoxyphenyl)-3-methylbut-3-en-1-amine (PubChem CID 105004270) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-methylbut-3-en-1-amine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105004270 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)CC(N)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C12H16FNO/c1-8(2)6-11(14)9-4-5-12(15-3)10(13)7-9/h4-5,7,11H,1,6,14H2,2-3H3 |
| InChIKey | NQIINHFBYBSTOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|