About 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide
2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide (PubChem CID 10500538) has the molecular formula C18H19N3O5S
and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide |
| PubChem CID | 10500538 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide |
| SMILES | CC(C)(C)NC(=O)c1c(SCc2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O5S/c1-18(2,3)19-17(22)16-14(21(25)26)9-13(20(23)24)10-15(16)27-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,19,22) |
| InChIKey | KTKPVOJLWAQMGE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide?
The IUPAC name of 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide (CID 10500538) is 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide.
What is the SMILES notation for 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide?
The canonical SMILES for 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide is CC(C)(C)NC(=O)c1c(SCc2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide?
The InChIKey is KTKPVOJLWAQMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5S/c1-18(2,3)19-17(22)16-14(21(25)26)9-13(20(23)24)10-15(16)27-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,19,22).
What are the key properties of 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide?
2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide has a molecular weight of 389.43 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-N-tert-butyl-4,6-dinitrobenzamide is sourced from PubChem (CID 10500538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).