C15H19BrF3N — CID 105006031
1-[4-bromo-3-(trifluoromethyl)phenyl]-N-ethyl-3-methylidenepentan-1-amine (PubChem CID 105006031) has the molecular formula C15H19BrF3N and a molecular weight of 350.22 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-ethyl-3-methylidenepentan-1-amine.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-ethyl-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 105006031 |
| Molecular Formula | C15H19BrF3N |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-ethyl-3-methylidenepentan-1-amine |
| SMILES | C=C(CC)CC(NCC)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19BrF3N/c1-4-10(3)8-14(20-5-2)11-6-7-13(16)12(9-11)15(17,18)19/h6-7,9,14,20H,3-5,8H2,1-2H3 |
| InChIKey | BROBXWSEDVTQJV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|