C13H22N2 — CID 105006266
N,2-dimethyl-1-(4-methyl-3-pyridinyl)pentan-1-amine (PubChem CID 105006266) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N,2-dimethyl-1-(4-methyl-3-pyridinyl)pentan-1-amine.
| Compound Name | N,2-dimethyl-1-(4-methyl-3-pyridinyl)pentan-1-amine |
|---|---|
| PubChem CID | 105006266 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N,2-dimethyl-1-(4-methyl-3-pyridinyl)pentan-1-amine |
| SMILES | CCCC(C)C(NC)c1cnccc1C |
| InChI | InChI=1S/C13H22N2/c1-5-6-11(3)13(14-4)12-9-15-8-7-10(12)2/h7-9,11,13-14H,5-6H2,1-4H3 |
| InChIKey | QAPZSSOZCLTOMH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |