C16H17BrClNO2 — CID 105006891
1-(4-bromo-2-methoxyphenyl)-1-(4-chloro-3-methoxyphenyl)-N-methylmethanamine (PubChem CID 105006891) has the molecular formula C16H17BrClNO2 and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-1-(4-chloro-3-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-1-(4-chloro-3-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105006891 |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-1-(4-chloro-3-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)c(OC)c1)c1ccc(Br)cc1OC |
| InChI | InChI=1S/C16H17BrClNO2/c1-19-16(10-4-7-13(18)15(8-10)21-3)12-6-5-11(17)9-14(12)20-2/h4-9,16,19H,1-3H3 |
| InChIKey | UWWMVSLOHUQASV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |