C26H32O3 — CID 10500739
(6R,8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenylmethoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10500739) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenylmethoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenylmethoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10500739 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenylmethoxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C=C1[C@H](OCc1ccccc1)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H32O3/c1-25-12-10-18(27)14-22(25)23(29-16-17-6-4-3-5-7-17)15-19-20-8-9-24(28)26(20,2)13-11-21(19)25/h3-7,14,19-21,23H,8-13,15-16H2,1-2H3/t19-,20-,21-,23+,25+,26-/m0/s1 |
| InChIKey | FENZYWUSZAFNEI-MLJDGYFNSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |