C15H31NO — CID 105008553
N-[2-propoxy-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]propan-1-amine (PubChem CID 105008553) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N-[2-propoxy-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]propan-1-amine.
| Compound Name | N-[2-propoxy-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105008553 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-[2-propoxy-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]propan-1-amine |
| SMILES | CCCNC(COCCC)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H31NO/c1-7-9-16-12(11-17-10-8-2)13-14(3,4)15(13,5)6/h12-13,16H,7-11H2,1-6H3 |
| InChIKey | UKZGWZAHAWTCJQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|