C20H21N5O4 — CID 10500891
(2R,3S,4R,5E)-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentane-1,2,3,4-tetrol (PubChem CID 10500891) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is (2R,3S,4R,5E)-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R,5E)-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10500891 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2R,3S,4R,5E)-5-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)/C=N/Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N5O4/c26-12-16(28)19(29)15(27)11-21-24-20-22-17(13-7-3-1-4-8-13)18(23-25-20)14-9-5-2-6-10-14/h1-11,15-16,19,26-29H,12H2,(H,22,24,25)/b21-11+/t15-,16-,19+/m1/s1 |
| InChIKey | MCNKMVHPGAGZDB-RCBIBYLRSA-N |
| XLogP | 0.68 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|