About 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine
2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine (PubChem CID 105008984) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine |
| PubChem CID | 105008984 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine |
| SMILES | COCC(N)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C10H21NO2/c1-6-7(2)13-8(3)10(6)9(11)5-12-4/h6-10H,5,11H2,1-4H3 |
| InChIKey | SJZQDPWITFKFNF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The IUPAC name of 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine (CID 105008984) is 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine.
What is the SMILES notation for 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The canonical SMILES for 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine is COCC(N)C1C(C)OC(C)C1C.
What is the InChIKey of 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The InChIKey is SJZQDPWITFKFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-6-7(2)13-8(3)10(6)9(11)5-12-4/h6-10H,5,11H2,1-4H3.
What are the key properties of 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine has a molecular weight of 187.28 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine is sourced from PubChem (CID 105008984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).