C24H44O4 — CID 10500963
ethyl (E)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-enoate (PubChem CID 10500963) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is ethyl (E)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-enoate.
| Compound Name | ethyl (E)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-enoate |
|---|---|
| PubChem CID | 10500963 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | ethyl (E)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-enoate |
| SMILES | CCCCCCCCCC[C@@H]1OC(C)(C)O[C@@H]1CC/C=C/CCC(=O)OCC |
| InChI | InChI=1S/C24H44O4/c1-5-7-8-9-10-11-12-15-18-21-22(28-24(3,4)27-21)19-16-13-14-17-20-23(25)26-6-2/h13-14,21-22H,5-12,15-20H2,1-4H3/b14-13+/t21-,22+/m0/s1 |
| InChIKey | USBCISSWYJZYSE-KMWGMXNCSA-N |
| XLogP | 6.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|