C16H21BrClNO — CID 105010358
1-(5-bromo-2-chlorophenyl)-N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)methanamine (PubChem CID 105010358) has the molecular formula C16H21BrClNO and a molecular weight of 358.71 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)methanamine.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)methanamine |
|---|---|
| PubChem CID | 105010358 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)methanamine |
| SMILES | CNC(c1cc(Br)ccc1Cl)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H21BrClNO/c1-19-15(13-9-12(17)3-4-14(13)18)11-5-8-20-16(10-11)6-2-7-16/h3-4,9,11,15,19H,2,5-8,10H2,1H3 |
| InChIKey | PXWNMHQKYQUXTP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |