C15H30N2O3S — CID 105011091
N-ethyl-1-(3-methyloxolan-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine (PubChem CID 105011091) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is N-ethyl-1-(3-methyloxolan-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine.
| Compound Name | N-ethyl-1-(3-methyloxolan-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 105011091 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-ethyl-1-(3-methyloxolan-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
| SMILES | CCNC(CC1CCCN(S(C)(=O)=O)C1)C1OCCC1C |
| InChI | InChI=1S/C15H30N2O3S/c1-4-16-14(15-12(2)7-9-20-15)10-13-6-5-8-17(11-13)21(3,18)19/h12-16H,4-11H2,1-3H3 |
| InChIKey | YDJUCNHBYZIGCP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |