C16H17BrFNO — CID 105011823
1-(5-bromo-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)-N-methylmethanamine (PubChem CID 105011823) has the molecular formula C16H17BrFNO and a molecular weight of 338.22 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105011823 |
| Molecular Formula | C16H17BrFNO |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(C)c(OC)c1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C16H17BrFNO/c1-10-4-5-11(8-15(10)20-3)16(19-2)13-9-12(17)6-7-14(13)18/h4-9,16,19H,1-3H3 |
| InChIKey | XOXKUFDHDDUJKT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |