C27H31NO2 — CID 10501249
(1R,2R,4S,6S,9S,11R)-6-benzyl-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one (PubChem CID 10501249) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (1R,2R,4S,6S,9S,11R)-6-benzyl-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one.
| Compound Name | (1R,2R,4S,6S,9S,11R)-6-benzyl-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
|---|---|
| PubChem CID | 10501249 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (1R,2R,4S,6S,9S,11R)-6-benzyl-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
| SMILES | CC1(C)[C@H]2C[C@@H]3N4C(=O)[C@@H](Cc5ccccc5)C[C@@]4(c4ccccc4)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C27H31NO2/c1-25(2)21-15-22(25)26(3)23(16-21)28-24(29)19(14-18-10-6-4-7-11-18)17-27(28,30-26)20-12-8-5-9-13-20/h4-13,19,21-23H,14-17H2,1-3H3/t19-,21+,22+,23-,26+,27-/m0/s1 |
| InChIKey | ZVKYGSNEGFQOIA-ZZJUZBICSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |