C18H33N3 — CID 105012509
4-cyclohexyl-N-ethyl-1-(1-propylimidazol-2-yl)butan-2-amine (PubChem CID 105012509) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 4-cyclohexyl-N-ethyl-1-(1-propylimidazol-2-yl)butan-2-amine.
| Compound Name | 4-cyclohexyl-N-ethyl-1-(1-propylimidazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 105012509 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 4-cyclohexyl-N-ethyl-1-(1-propylimidazol-2-yl)butan-2-amine |
| SMILES | CCCn1ccnc1CC(CCC1CCCCC1)NCC |
| InChI | InChI=1S/C18H33N3/c1-3-13-21-14-12-20-18(21)15-17(19-4-2)11-10-16-8-6-5-7-9-16/h12,14,16-17,19H,3-11,13,15H2,1-2H3 |
| InChIKey | FQCUNGOIBIWBFE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |