C20H14F4N4O — CID 10501266
4-(1H-indol-3-yl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 10501266) has the molecular formula C20H14F4N4O and a molecular weight of 402.35 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1H-indol-3-yl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10501266 |
| Molecular Formula | C20H14F4N4O |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3c[nH]c4ccccc34)n2)c1 |
| InChI | InChI=1S/C20H14F4N4O/c21-18(22)20(23,24)29-13-5-3-4-12(10-13)27-19-25-9-8-17(28-19)15-11-26-16-7-2-1-6-14(15)16/h1-11,18,26H,(H,25,27,28) |
| InChIKey | HCZZACRTGWSLPL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|