About 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine
1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine (PubChem CID 105012891) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine |
| PubChem CID | 105012891 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine |
| SMILES | CC(C)C(C)C(N)CC1CC2CCC1C2 |
| InChI | InChI=1S/C14H27N/c1-9(2)10(3)14(15)8-13-7-11-4-5-12(13)6-11/h9-14H,4-8,15H2,1-3H3 |
| InChIKey | LNFSUKIXZIXSHC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine?
The IUPAC name of 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine (CID 105012891) is 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine.
What is the SMILES notation for 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine?
The canonical SMILES for 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine is CC(C)C(C)C(N)CC1CC2CCC1C2.
What is the InChIKey of 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine?
The InChIKey is LNFSUKIXZIXSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N/c1-9(2)10(3)14(15)8-13-7-11-4-5-12(13)6-11/h9-14H,4-8,15H2,1-3H3.
What are the key properties of 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine?
1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine has a molecular weight of 209.38 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bicyclo[2.2.1]heptanyl)-3,4-dimethylpentan-2-amine is sourced from PubChem (CID 105012891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).