C24H28N4O2 — CID 10501415
15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione (PubChem CID 10501415) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione.
| Compound Name | 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10501415 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
| SMILES | CN(C)CCNc1ccc2c3c(c4ccccc4cc13)C(=O)N(CCN(C)C)C2=O |
| InChI | InChI=1S/C24H28N4O2/c1-26(2)12-11-25-20-10-9-18-21-19(20)15-16-7-5-6-8-17(16)22(21)24(30)28(23(18)29)14-13-27(3)4/h5-10,15,25H,11-14H2,1-4H3 |
| InChIKey | YQNKITKMOLERFY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|