C18H23F3NO6- — CID 10501487
3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid;2,2,2-trifluoroacetate (PubChem CID 10501487) has the molecular formula C18H23F3NO6- and a molecular weight of 406.38 g/mol. Its IUPAC name is 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10501487 |
| Molecular Formula | C18H23F3NO6- |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid;2,2,2-trifluoroacetate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(OC(=O)CCN)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H23NO4.C2HF3O2/c1-10-7-11(2)15(16(3,4)9-13(18)19)12(8-10)21-14(20)5-6-17;3-2(4,5)1(6)7/h7-8H,5-6,9,17H2,1-4H3,(H,18,19);(H,6,7)/p-1 |
| InChIKey | VEGMRHHOZIJDGG-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|