C21H27BrO3 — CID 10501542
[5-bromo-4-methoxy-2-[(5,7,7-trimethylspiro[2.5]oct-4-en-8-yl)methyl]phenyl] acetate (PubChem CID 10501542) has the molecular formula C21H27BrO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is [5-bromo-4-methoxy-2-[(5,7,7-trimethylspiro[2.5]oct-4-en-8-yl)methyl]phenyl] acetate.
| Compound Name | [5-bromo-4-methoxy-2-[(5,7,7-trimethylspiro[2.5]oct-4-en-8-yl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 10501542 |
| Molecular Formula | C21H27BrO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [5-bromo-4-methoxy-2-[(5,7,7-trimethylspiro[2.5]oct-4-en-8-yl)methyl]phenyl] acetate |
| SMILES | COc1cc(CC2C(C)(C)CC(C)=CC23CC3)c(OC(C)=O)cc1Br |
| InChI | InChI=1S/C21H27BrO3/c1-13-11-20(3,4)19(21(12-13)6-7-21)9-15-8-18(24-5)16(22)10-17(15)25-14(2)23/h8,10,12,19H,6-7,9,11H2,1-5H3 |
| InChIKey | PMLKFXMDGNDNEI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|