C18H33NO9 — CID 10501555
methyl (4S,5R,6R)-5-[acetyl(methyl)amino]-2,4-dimethoxy-6-[(1S,2R)-1,2,3-trimethoxypropyl]oxane-2-carboxylate (PubChem CID 10501555) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is methyl (4S,5R,6R)-5-[acetyl(methyl)amino]-2,4-dimethoxy-6-[(1S,2R)-1,2,3-trimethoxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (4S,5R,6R)-5-[acetyl(methyl)amino]-2,4-dimethoxy-6-[(1S,2R)-1,2,3-trimethoxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10501555 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | methyl (4S,5R,6R)-5-[acetyl(methyl)amino]-2,4-dimethoxy-6-[(1S,2R)-1,2,3-trimethoxypropyl]oxane-2-carboxylate |
| SMILES | COC[C@@H](OC)[C@@H](OC)[C@@H]1OC(OC)(C(=O)OC)C[C@H](OC)[C@H]1N(C)C(C)=O |
| InChI | InChI=1S/C18H33NO9/c1-11(20)19(2)14-12(23-4)9-18(27-8,17(21)26-7)28-16(14)15(25-6)13(24-5)10-22-3/h12-16H,9-10H2,1-8H3/t12-,13+,14+,15+,16+,18?/m0/s1 |
| InChIKey | MZOHQTJZVTXPHS-NRHWOBRCSA-N |
| XLogP | -0.17 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |