C15H15BrFNO2S — CID 105015570
2-(3-bromo-5-fluorophenyl)-1-(3-methylsulfonylphenyl)ethanamine (PubChem CID 105015570) has the molecular formula C15H15BrFNO2S and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(3-methylsulfonylphenyl)ethanamine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(3-methylsulfonylphenyl)ethanamine |
|---|---|
| PubChem CID | 105015570 |
| Molecular Formula | C15H15BrFNO2S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(3-methylsulfonylphenyl)ethanamine |
| SMILES | CS(=O)(=O)c1cccc(C(N)Cc2cc(F)cc(Br)c2)c1 |
| InChI | InChI=1S/C15H15BrFNO2S/c1-21(19,20)14-4-2-3-11(8-14)15(18)7-10-5-12(16)9-13(17)6-10/h2-6,8-9,15H,7,18H2,1H3 |
| InChIKey | LRBVHSLMWIKWQP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |