C23H29N5O2 — CID 10501566
2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-(2,4-dimethylphenyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 10501566) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-(2,4-dimethylphenyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-(2,4-dimethylphenyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10501566 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-(2,4-dimethylphenyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(CCN(C)c2nc(C)nc(Nc3ccc(C)cc3C)n2)cc1OC |
| InChI | InChI=1S/C23H29N5O2/c1-15-7-9-19(16(2)13-15)26-22-24-17(3)25-23(27-22)28(4)12-11-18-8-10-20(29-5)21(14-18)30-6/h7-10,13-14H,11-12H2,1-6H3,(H,24,25,26,27) |
| InChIKey | MOFRORNVGRSBQM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |