C15H14BrFIN — CID 105015718
2-(3-bromo-5-fluorophenyl)-1-(3-iodophenyl)-N-methylethanamine (PubChem CID 105015718) has the molecular formula C15H14BrFIN and a molecular weight of 434.09 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(3-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(3-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105015718 |
| Molecular Formula | C15H14BrFIN |
| Molecular Weight | 434.09 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(3-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(F)cc(Br)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C15H14BrFIN/c1-19-15(11-3-2-4-14(18)8-11)7-10-5-12(16)9-13(17)6-10/h2-6,8-9,15,19H,7H2,1H3 |
| InChIKey | QUJOLRQUDRMZMA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|