C16H28N2OS — CID 105015928
1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(oxan-2-yl)butan-2-amine (PubChem CID 105015928) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(oxan-2-yl)butan-2-amine.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(oxan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 105015928 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-(oxan-2-yl)butan-2-amine |
| SMILES | CC(C)(C)c1csc(CC(N)CCC2CCCCO2)n1 |
| InChI | InChI=1S/C16H28N2OS/c1-16(2,3)14-11-20-15(18-14)10-12(17)7-8-13-6-4-5-9-19-13/h11-13H,4-10,17H2,1-3H3 |
| InChIKey | ZJUOITGVMVZWNK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |