C18H21BrFN — CID 105016395
N-[(2-bromo-4-methylphenyl)-(3-fluoro-5-methylphenyl)methyl]propan-1-amine (PubChem CID 105016395) has the molecular formula C18H21BrFN and a molecular weight of 350.28 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)-(3-fluoro-5-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromo-4-methylphenyl)-(3-fluoro-5-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105016395 |
| Molecular Formula | C18H21BrFN |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)-(3-fluoro-5-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(C)cc(F)c1)c1ccc(C)cc1Br |
| InChI | InChI=1S/C18H21BrFN/c1-4-7-21-18(14-8-13(3)9-15(20)11-14)16-6-5-12(2)10-17(16)19/h5-6,8-11,18,21H,4,7H2,1-3H3 |
| InChIKey | MRSXFMCFJPRNAI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |