C12H16N2O10S2 — CID 10501815
[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl imidazole-1-sulfonate (PubChem CID 10501815) has the molecular formula C12H16N2O10S2 and a molecular weight of 412.40 g/mol. Its IUPAC name is [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl imidazole-1-sulfonate.
| Compound Name | [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl imidazole-1-sulfonate |
|---|---|
| PubChem CID | 10501815 |
| Molecular Formula | C12H16N2O10S2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,8,10,12-pentaoxa-4lambda6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl imidazole-1-sulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H]3OS(=O)(=O)O[C@@H]3CO[C@@]2(COS(=O)(=O)n2ccnc2)O1 |
| InChI | InChI=1S/C12H16N2O10S2/c1-11(2)21-10-9-8(22-26(17,18)23-9)5-19-12(10,24-11)6-20-25(15,16)14-4-3-13-7-14/h3-4,7-10H,5-6H2,1-2H3/t8-,9-,10+,12+/m1/s1 |
| InChIKey | STSHTNULLPBLGV-SVDPJWKOSA-N |
| XLogP | -1.10 |
| TPSA | 141.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |