C16H17Cl2N — CID 105018696
1-(2,6-dichlorophenyl)-1-(3-ethylphenyl)-N-methylmethanamine (PubChem CID 105018696) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-1-(3-ethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-1-(3-ethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105018696 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-1-(3-ethylphenyl)-N-methylmethanamine |
| SMILES | CCc1cccc(C(NC)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N/c1-3-11-6-4-7-12(10-11)16(19-2)15-13(17)8-5-9-14(15)18/h4-10,16,19H,3H2,1-2H3 |
| InChIKey | PJCBJIBJUGFUAJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |