C24H23N5O2 — CID 10501880
N',N'-dimethyl-N-(16-nitro-4,12-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14(19),15,17,20-decaen-3-yl)propane-1,3-diamine (PubChem CID 10501880) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-(16-nitro-4,12-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14(19),15,17,20-decaen-3-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(16-nitro-4,12-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14(19),15,17,20-decaen-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10501880 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N',N'-dimethyl-N-(16-nitro-4,12-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14(19),15,17,20-decaen-3-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc2ccccc2c2[nH]c3c4cc([N+](=O)[O-])ccc4ccc3c12 |
| InChI | InChI=1S/C24H23N5O2/c1-28(2)13-5-12-25-24-21-18-11-9-15-8-10-16(29(30)31)14-19(15)22(18)27-23(21)17-6-3-4-7-20(17)26-24/h3-4,6-11,14,27H,5,12-13H2,1-2H3,(H,25,26) |
| InChIKey | VENNTGMAZAZSJZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|