C17H25BrFN — CID 105020439
1-(2-bromo-3-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine (PubChem CID 105020439) has the molecular formula C17H25BrFN and a molecular weight of 342.30 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 105020439 |
| Molecular Formula | C17H25BrFN |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine |
| SMILES | CCNC(Cc1cccc(F)c1Br)CC1CCCCC1 |
| InChI | InChI=1S/C17H25BrFN/c1-2-20-15(11-13-7-4-3-5-8-13)12-14-9-6-10-16(19)17(14)18/h6,9-10,13,15,20H,2-5,7-8,11-12H2,1H3 |
| InChIKey | LDCCWTKFNHTIQK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |