C18H22N2 — CID 105021311
N-[6-bicyclo[3.1.0]hexanyl(quinolin-8-yl)methyl]ethanamine (PubChem CID 105021311) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-[6-bicyclo[3.1.0]hexanyl(quinolin-8-yl)methyl]ethanamine.
| Compound Name | N-[6-bicyclo[3.1.0]hexanyl(quinolin-8-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105021311 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[6-bicyclo[3.1.0]hexanyl(quinolin-8-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccc2cccnc12)C1C2CCCC21 |
| InChI | InChI=1S/C18H22N2/c1-2-19-18(16-13-8-4-9-14(13)16)15-10-3-6-12-7-5-11-20-17(12)15/h3,5-7,10-11,13-14,16,18-19H,2,4,8-9H2,1H3 |
| InChIKey | KFWCDXYGWWZHHE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |