C26H42O4 — CID 10502145
(3S,6S,9R,10R,13R,15R,17R)-17-[(E,2R)-6-hydroxy-5-methylhex-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,15-triol (PubChem CID 10502145) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is (3S,6S,9R,10R,13R,15R,17R)-17-[(E,2R)-6-hydroxy-5-methylhex-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,15-triol.
| Compound Name | (3S,6S,9R,10R,13R,15R,17R)-17-[(E,2R)-6-hydroxy-5-methylhex-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,15-triol |
|---|---|
| PubChem CID | 10502145 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | (3S,6S,9R,10R,13R,15R,17R)-17-[(E,2R)-6-hydroxy-5-methylhex-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,15-triol |
| SMILES | CC(/C=C/[C@@H](C)[C@H]1C[C@@H](O)C2=C3C[C@H](O)C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C)CO |
| InChI | InChI=1S/C26H42O4/c1-15(14-27)5-6-16(2)20-13-23(30)24-18-12-22(29)21-11-17(28)7-9-25(21,3)19(18)8-10-26(20,24)4/h5-6,15-17,19-23,27-30H,7-14H2,1-4H3/b6-5+/t15?,16-,17+,19+,20-,21?,22+,23-,25-,26-/m1/s1 |
| InChIKey | ZAZQQOOBLLITLN-SKWUEVISSA-N |
| XLogP | 3.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|