C14H19NS — CID 105022064
1-(1-benzothiophen-7-yl)-2,3-dimethylbutan-1-amine (PubChem CID 105022064) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-2,3-dimethylbutan-1-amine.
| Compound Name | 1-(1-benzothiophen-7-yl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105022064 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(C)C(C)C(N)c1cccc2ccsc12 |
| InChI | InChI=1S/C14H19NS/c1-9(2)10(3)13(15)12-6-4-5-11-7-8-16-14(11)12/h4-10,13H,15H2,1-3H3 |
| InChIKey | BNCSJAYAKPLVLF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |