C13H24N2O3 — CID 105022135
tert-butyl N-[2-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]carbamate (PubChem CID 105022135) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 105022135 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl N-[2-(3,4-dihydro-2H-pyran-2-ylmethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCC1CCC=CO1 |
| InChI | InChI=1S/C13H24N2O3/c1-13(2,3)18-12(16)15-8-7-14-10-11-6-4-5-9-17-11/h5,9,11,14H,4,6-8,10H2,1-3H3,(H,15,16) |
| InChIKey | JDOHPMJWDIANDE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|