C24H24N2O5 — CID 10502224
2-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-2-(2-phenylacetyl)hydrazinyl]methyl]benzoic acid (PubChem CID 10502224) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-2-(2-phenylacetyl)hydrazinyl]methyl]benzoic acid.
| Compound Name | 2-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-2-(2-phenylacetyl)hydrazinyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10502224 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-hydroxy-3-[[2-[(4-methoxyphenyl)methyl]-2-(2-phenylacetyl)hydrazinyl]methyl]benzoic acid |
| SMILES | COc1ccc(CN(NCc2cccc(C(=O)O)c2O)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-31-20-12-10-18(11-13-20)16-26(22(27)14-17-6-3-2-4-7-17)25-15-19-8-5-9-21(23(19)28)24(29)30/h2-13,25,28H,14-16H2,1H3,(H,29,30) |
| InChIKey | OYTASNFZJCACCZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|