C12H20N2 — CID 105023232
2,3-dimethyl-1-(5-methyl-3-pyridinyl)butan-1-amine (PubChem CID 105023232) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,3-dimethyl-1-(5-methyl-3-pyridinyl)butan-1-amine.
| Compound Name | 2,3-dimethyl-1-(5-methyl-3-pyridinyl)butan-1-amine |
|---|---|
| PubChem CID | 105023232 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,3-dimethyl-1-(5-methyl-3-pyridinyl)butan-1-amine |
| SMILES | Cc1cncc(C(N)C(C)C(C)C)c1 |
| InChI | InChI=1S/C12H20N2/c1-8(2)10(4)12(13)11-5-9(3)6-14-7-11/h5-8,10,12H,13H2,1-4H3 |
| InChIKey | YMNGOEAPFSCZMU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |